CAS 2288708-81-4 is the registry number for 5,6-Dichloro-2,3-dihydro-1H-inden-1-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
5,6-dichloro-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 2288708-81-4) is a chemical compound with the molecular formula C9H10Cl3N and a molecular weight of 238.5 g/mol. IUPAC name: 5,6-dichloro-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: NHWFFNRUGPMUFR-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl3N |
|---|---|
| Molecular weight | 238.5 g/mol |
| IUPAC name | 5,6-dichloro-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | NHWFFNRUGPMUFR-UHFFFAOYSA-N |
| SMILES | C1CC2=CC(=C(C=C2C1N)Cl)Cl.Cl |
Computed by PubChem (NCBI)