CAS 73075-50-0 appears in our catalog under these names: 6,8-Dichloro-1,2,3,4-tetrahydroisoquinoline hydrochloride, 97%, 6,8-Dichloro-1,2,3,4-tetrahydroisoquinoline hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 50mg, 0,5g.
6,8-dichloro-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 73075-50-0) is a chemical compound with the molecular formula C9H10Cl3N and a molecular weight of 238.5 g/mol. IUPAC name: 6,8-dichloro-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: QKXXBZDVPZFIGG-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl3N |
|---|---|
| Molecular weight | 238.5 g/mol |
| IUPAC name | 6,8-dichloro-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | QKXXBZDVPZFIGG-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1C=C(C=C2Cl)Cl.Cl |
Computed by PubChem (NCBI)