CAS 1306604-67-0 appears in our catalog under these names: 4,5-Dichloro-2,3-dihydro-1h-inden-1-amine hydrochloride, 95%, 4,5-Dichloro-2,3-dihydro-1h-inden-1-amine hcl, 95%, 4,5-Dichloro-2,3-dihydro-1H-inden-1-amine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 50mg, 1000mg, 500mg.
4,5-dichloro-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 1306604-67-0) is a chemical compound with the molecular formula C9H10Cl3N and a molecular weight of 238.5 g/mol. IUPAC name: 4,5-dichloro-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: ICIBFUJIWWXRFH-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl3N |
|---|---|
| Molecular weight | 238.5 g/mol |
| IUPAC name | 4,5-dichloro-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | ICIBFUJIWWXRFH-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1N)C=CC(=C2Cl)Cl.Cl |
Computed by PubChem (NCBI)