CAS 73075-47-5 appears in our catalog under these names: Lifitegrast Impurity 42 HCl, 5,7–Dichloro–1,2,3,4–tetrahydroisoquinoline hydrochloride, 5,7-Dichloro-1,2,3,4-tetrahydroisoquinoline hydrochloride, 5,7-Dichloro-1,2,3,4-tetrahydroisoquinoline hydrochloride 97%, 5,7-Dichloro-1,2,3,4-tetrahydroisoquinoline Hydrochloride, 97%, 97%. Offered by: Chemat Brand, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: on request, 100mg, 1g, 250mg, 2,5g, 10g, 5g, 2.5g.
5,7-dichloro-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 73075-47-5) is a chemical compound with the molecular formula C9H10Cl3N and a molecular weight of 238.5 g/mol. IUPAC name: 5,7-dichloro-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: OQLXYGUEFSFZIX-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl3N |
|---|---|
| Molecular weight | 238.5 g/mol |
| IUPAC name | 5,7-dichloro-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | OQLXYGUEFSFZIX-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1C(=CC(=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)