CAS 1423024-30-9 appears in our catalog under these names: 6,8-Dichloro-1,2,3,4-tetrahydroquinoline hydrochloride, 95%, 6,8-Dichloro-1,2,3,4-tetrahydroquinoline hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 50mg, 0,5g.
6,8-dichloro-1,2,3,4-tetrahydroquinoline;hydrochloride (CAS 1423024-30-9) is a chemical compound with the molecular formula C9H10Cl3N and a molecular weight of 238.5 g/mol. IUPAC name: 6,8-dichloro-1,2,3,4-tetrahydroquinoline;hydrochloride. InChIKey: AOQLVYHSDZZFEZ-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl3N |
|---|---|
| Molecular weight | 238.5 g/mol |
| IUPAC name | 6,8-dichloro-1,2,3,4-tetrahydroquinoline;hydrochloride |
| InChIKey | AOQLVYHSDZZFEZ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=CC(=C2)Cl)Cl)NC1.Cl |
Computed by PubChem (NCBI)