CAS 1315365-55-9 appears in our catalog under these names: (2-(4-Nitrophenyl)-1,3-oxazol-5-yl)methanol, 95%, (2-(4-Nitrophenyl)-1,3-oxazol-5-yl)methanol, [2-(4-NITROPHENYL)-1,3-OXAZOL-5-YL]METHANOL, 95%, 95%, [2-(4-Nitrophenyl)-1,3-oxazol-5-yl]methanol, 95%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 1g, 0,5g, 50mg, 100mg, 250mg.
[2-(4-nitrophenyl)-1,3-oxazol-5-yl]methanol (CAS 1315365-55-9) is a chemical compound with the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. IUPAC name: [2-(4-nitrophenyl)-1,3-oxazol-5-yl]methanol. InChIKey: FASWZHQOPDYKJG-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O4 |
|---|---|
| Molecular weight | 220.18 g/mol |
| IUPAC name | [2-(4-nitrophenyl)-1,3-oxazol-5-yl]methanol |
| InChIKey | FASWZHQOPDYKJG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC=C(O2)CO)[N+](=O)[O-] |
Computed by PubChem (NCBI)