CAS 1322643-80-0 appears in our catalog under these names: 1,3,6,7-Tetrahydro-2H-benzofuro[5,6-d]imidazole-2-thione, 98%, 1,3,6,7-Tetrahydro-2H-furo[2,3-f]benzimidazole-2-thione, 98%, 98%, 3,4A,6,7-tetrahydro-2H-benzofuro[5,6-d]imidazole-2-thione, 98%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 250mg, 1g, 5g.
1,3,6,7-tetrahydrofuro[2,3-f]benzimidazole-2-thione (CAS 1322643-80-0) is a chemical compound with the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. IUPAC name: 1,3,6,7-tetrahydrofuro[2,3-f]benzimidazole-2-thione. InChIKey: MACIMWZQLSJIGW-UHFFFAOYSA-N.
| Molecular formula | C9H8N2OS |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | 1,3,6,7-tetrahydrofuro[2,3-f]benzimidazole-2-thione |
| InChIKey | MACIMWZQLSJIGW-UHFFFAOYSA-N |
| SMILES | C1COC2=CC3=C(C=C21)NC(=S)N3 |
Computed by PubChem (NCBI)