CAS 13280-60-9 appears in our catalog under these names: 5-Amino-2-nitrobenzoic Acid, 5–Amino–2–nitrobenzoic acid, 5-Amino-2-nitrobenzoic acid, 95% , 5-Amino-2-nitrobenzoic Acid, >98.0%(T), 5-Amino-2-nitrobenzoic Acid (Purified) [for gamma-GT], >99.0%(HPLC). Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI. Available pack sizes: 10g, 25g, 5g, 100g, 50g, 100mg, 250g, 500g.
5-amino-2-nitrobenzoic acid (CAS 13280-60-9) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 5-amino-2-nitrobenzoic acid. InChIKey: KZZWQCKYLNIOBT-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 5-amino-2-nitrobenzoic acid |
| InChIKey | KZZWQCKYLNIOBT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)