CAS 1335053-95-6 appears in our catalog under these names: 1,6-Dichloro-2,7-naphthyridine, 95%, 1,6-Dichloro-2,7-naphthyridine, 97%, 1,6-dichloro-2,7-naphthyridine, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
1,6-dichloro-2,7-naphthyridine (CAS 1335053-95-6) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 1,6-dichloro-2,7-naphthyridine. InChIKey: LTXRMNQJZVJVER-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 1,6-dichloro-2,7-naphthyridine |
| InChIKey | LTXRMNQJZVJVER-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C2=CN=C(C=C21)Cl)Cl |
Computed by PubChem (NCBI)