CAS 1335234-26-8 appears in our catalog under these names: (2-[(2,4-Difluorophenyl)methoxy]phenyl)boranediol, 95%, {2-((2,4-Difluorophenyl)methoxy)phenyl}boronic acid, (2-((2,4-Difluorobenzyl)oxy)phenyl)boronic acid, 95%, 95%, (2-((2,4-Difluorobenzyl)oxy)phenyl)boronic acid, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 5g, 1g, 10g, 250mg, 2,5g.
[2-[(2,4-difluorophenyl)methoxy]phenyl]boronic acid (CAS 1335234-26-8) is a chemical compound with the molecular formula C13H11BF2O3 and a molecular weight of 264.03 g/mol. IUPAC name: [2-[(2,4-difluorophenyl)methoxy]phenyl]boronic acid. InChIKey: WHTAOABISMWPQO-UHFFFAOYSA-N.
| Molecular formula | C13H11BF2O3 |
|---|---|
| Molecular weight | 264.03 g/mol |
| IUPAC name | [2-[(2,4-difluorophenyl)methoxy]phenyl]boronic acid |
| InChIKey | WHTAOABISMWPQO-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1OCC2=C(C=C(C=C2)F)F)(O)O |
Computed by PubChem (NCBI)