CAS 1340574-52-8 appears in our catalog under these names: (4-(Pyridin-2-yl)-1,3-thiazol-2-yl)methanol, 98%, (4-(Pyridin-2-yl)-1,3-thiazol-2-yl)methanol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
(4-pyridin-2-yl-1,3-thiazol-2-yl)methanol (CAS 1340574-52-8) is a chemical compound with the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. IUPAC name: (4-pyridin-2-yl-1,3-thiazol-2-yl)methanol. InChIKey: HRRZIYSZZKAVOA-UHFFFAOYSA-N.
| Molecular formula | C9H8N2OS |
|---|---|
| Molecular weight | 192.24 g/mol |
| IUPAC name | (4-pyridin-2-yl-1,3-thiazol-2-yl)methanol |
| InChIKey | HRRZIYSZZKAVOA-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CSC(=N2)CO |
Computed by PubChem (NCBI)