CAS 1341992-64-0 appears in our catalog under these names: 4-{((9H-fluoren-9-ylmethoxy)carbonyl)amino}-2-methylbenzoic acid, 95%, 4-{((9H-Fluoren-9-ylmethoxy)carbonyl)amino}-2-methylbenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
4-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylbenzoic acid (CAS 1341992-64-0) is a chemical compound with the molecular formula C23H19NO4 and a molecular weight of 373.4 g/mol. IUPAC name: 4-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylbenzoic acid. InChIKey: NWDAFWBFAHCYKV-UHFFFAOYSA-N.
| Molecular formula | C23H19NO4 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | 4-(9H-fluoren-9-ylmethoxycarbonylamino)-2-methylbenzoic acid |
| InChIKey | NWDAFWBFAHCYKV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)