Products 1346603-02-8
CAS 1346603-02-8 is the registry number for Hydralazine-15N4 Hydrochloride. Offered by: TRC. Available pack sizes: 25mg.
(15N)(15N)phthalazin-1-yl(15N)hydrazine;hydrochloride (CAS 1346603-02-8) is a chemical compound with the molecular formula C8H9ClN4 and a molecular weight of 200.61 g/mol. IUPAC name: (15N)(15N)phthalazin-1-yl(15N)hydrazine;hydrochloride. InChIKey: ZUXNZUWOTSUBMN-AKMRHMBASA-N.
| Molecular formula | C8H9ClN4 |
|---|---|
| Molecular weight | 200.61 g/mol |
| IUPAC name | (15N)(15N)phthalazin-1-yl(15N)hydrazine;hydrochloride |
| InChIKey | ZUXNZUWOTSUBMN-AKMRHMBASA-N |
| SMILES | C1=CC=C2C(=C1)C=[15N][15N]=C2[15NH][15NH2].Cl |
Computed by PubChem (NCBI)