Products 2749234-32-8
CAS 2749234-32-8 appears in our catalog under these names: Hydralazine-D4 Hydrochloride, Hydralazine–d4 (hydrochloride), Hydralazine-d4 (hydrochloride), 0.997%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 50mg, 1mg, 1 mg.
(5,6,7,8-tetradeuteriophthalazin-1-yl)hydrazine;hydrochloride (CAS 2749234-32-8) is a chemical compound with the molecular formula C8H9ClN4 and a molecular weight of 200.66 g/mol. IUPAC name: (5,6,7,8-tetradeuteriophthalazin-1-yl)hydrazine;hydrochloride. InChIKey: ZUXNZUWOTSUBMN-FOMJDCLLSA-N.
| Molecular formula | C8H9ClN4 |
|---|---|
| Molecular weight | 200.66 g/mol |
| IUPAC name | (5,6,7,8-tetradeuteriophthalazin-1-yl)hydrazine;hydrochloride |
| InChIKey | ZUXNZUWOTSUBMN-FOMJDCLLSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C=NN=C2NN)[2H])[2H].Cl |
Computed by PubChem (NCBI)