Products 1350468-89-1
CAS 1350468-89-1 is the registry number for Dimethyl 2-(3-Methyl-4-nitrophenyl)malonate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
Dimethyl 2-(3-methyl-4-nitrophenyl)propanedioate (CAS 1350468-89-1) is a chemical compound with the molecular formula C12H13NO6 and a molecular weight of 267.23 g/mol. IUPAC name: dimethyl 2-(3-methyl-4-nitrophenyl)propanedioate. InChIKey: CNICFJUBZDBLNU-UHFFFAOYSA-N.
| Molecular formula | C12H13NO6 |
|---|---|
| Molecular weight | 267.23 g/mol |
| IUPAC name | dimethyl 2-(3-methyl-4-nitrophenyl)propanedioate |
| InChIKey | CNICFJUBZDBLNU-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(C(=O)OC)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)