CAS 17335-88-5 appears in our catalog under these names: N-(Benzyloxycarbonyl)aminodiacetic Acid, 2,2'-(((Benzyloxy)carbonyl)azanediyl)diacetic acid, 95+%. Offered by: TRC, AmBeed. Available pack sizes: 10g, 100mg, 50mg.
2-[carboxymethyl(phenylmethoxycarbonyl)amino]acetic acid (CAS 17335-88-5) is a chemical compound with the molecular formula C12H13NO6 and a molecular weight of 267.23 g/mol. IUPAC name: 2-[carboxymethyl(phenylmethoxycarbonyl)amino]acetic acid. InChIKey: VOABBQIQCAKTIC-UHFFFAOYSA-N.
| Molecular formula | C12H13NO6 |
|---|---|
| Molecular weight | 267.23 g/mol |
| IUPAC name | 2-[carboxymethyl(phenylmethoxycarbonyl)amino]acetic acid |
| InChIKey | VOABBQIQCAKTIC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N(CC(=O)O)CC(=O)O |
Computed by PubChem (NCBI)