Products 22959-13-3
CAS 22959-13-3 is the registry number for 2-Nitro Iso-apiole. Offered by: TRC. Available pack sizes: 750mg.
4,7-dimethoxy-5-[(Z)-2-nitroprop-1-enyl]-1,3-benzodioxole (CAS 22959-13-3) is a chemical compound with the molecular formula C12H13NO6 and a molecular weight of 267.23 g/mol. IUPAC name: 4,7-dimethoxy-5-[(Z)-2-nitroprop-1-enyl]-1,3-benzodioxole. InChIKey: WQRDYLOJWQMEFW-DAXSKMNVSA-N.
| Molecular formula | C12H13NO6 |
|---|---|
| Molecular weight | 267.23 g/mol |
| IUPAC name | 4,7-dimethoxy-5-[(Z)-2-nitroprop-1-enyl]-1,3-benzodioxole |
| InChIKey | WQRDYLOJWQMEFW-DAXSKMNVSA-N |
| SMILES | C/C(=C/C1=CC(=C2C(=C1OC)OCO2)OC)/[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
2-Nitro Iso-apiole