CAS 39020-35-4 appears in our catalog under these names: diethyl 2-nitroterephthalate, Diethyl 2-nitroterephthalate, 95%. Offered by: Chemat Brand, AmBeed. Available pack sizes: on request, 1g.
Diethyl 2-nitrobenzene-1,4-dicarboxylate (CAS 39020-35-4) is a chemical compound with the molecular formula C12H13NO6 and a molecular weight of 267.23 g/mol. IUPAC name: diethyl 2-nitrobenzene-1,4-dicarboxylate. InChIKey: ADPASYSZBOYEJM-UHFFFAOYSA-N.
| Molecular formula | C12H13NO6 |
|---|---|
| Molecular weight | 267.23 g/mol |
| IUPAC name | diethyl 2-nitrobenzene-1,4-dicarboxylate |
| InChIKey | ADPASYSZBOYEJM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)C(=O)OCC)[N+](=O)[O-] |
Computed by PubChem (NCBI)