Products 135414-50-5
CAS 135414-50-5 is the registry number for 1,3-Dioxo-3,3a,7,7a-tetrahydro-4,7-epoxyisobenzofuran-4(1H)-yl pivalate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3,5-dioxo-4,10-dioxatricyclo[5.2.1.02,6]dec-8-en-1-yl) 2,2-dimethylpropanoate (CAS 135414-50-5) is a chemical compound with the molecular formula C13H14O6 and a molecular weight of 266.25 g/mol. IUPAC name: (3,5-dioxo-4,10-dioxatricyclo[5.2.1.02,6]dec-8-en-1-yl) 2,2-dimethylpropanoate. InChIKey: BBZNBNYGZBGIBD-UHFFFAOYSA-N.
| Molecular formula | C13H14O6 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | (3,5-dioxo-4,10-dioxatricyclo[5.2.1.02,6]dec-8-en-1-yl) 2,2-dimethylpropanoate |
| InChIKey | BBZNBNYGZBGIBD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)OC12C=CC(O1)C3C2C(=O)OC3=O |
Computed by PubChem (NCBI)