Products 39757-32-9
CAS 39757-32-9 is the registry number for Methyl 4-(2,4-dimethoxyphenyl)-2,4-dioxobutanoate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
Methyl 4-(2,4-dimethoxyphenyl)-2,4-dioxobutanoate (CAS 39757-32-9) is a chemical compound with the molecular formula C13H14O6 and a molecular weight of 266.25 g/mol. IUPAC name: methyl 4-(2,4-dimethoxyphenyl)-2,4-dioxobutanoate. InChIKey: WOSJZWHIEQGBCJ-UHFFFAOYSA-N.
| Molecular formula | C13H14O6 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | methyl 4-(2,4-dimethoxyphenyl)-2,4-dioxobutanoate |
| InChIKey | WOSJZWHIEQGBCJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)CC(=O)C(=O)OC)OC |
Computed by PubChem (NCBI)