CAS 214273-21-9 is the registry number for (2S)-4-(Acetyloxy)-1,3-dioxolane-2-methanol Benzoate. Offered by: TRC. Available pack sizes: 75mg.
[(2S)-4-acetyloxy-1,3-dioxolan-2-yl]methyl benzoate (CAS 214273-21-9) is a chemical compound with the molecular formula C13H14O6 and a molecular weight of 266.25 g/mol. IUPAC name: [(2S)-4-acetyloxy-1,3-dioxolan-2-yl]methyl benzoate. InChIKey: HZFOOXNVWXVDJP-PXYINDEMSA-N.
| Molecular formula | C13H14O6 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | [(2S)-4-acetyloxy-1,3-dioxolan-2-yl]methyl benzoate |
| InChIKey | HZFOOXNVWXVDJP-PXYINDEMSA-N |
| SMILES | CC(=O)OC1CO[C@@H](O1)COC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)