Products 65718-85-6
CAS 65718-85-6 is the registry number for Dihydrocitrinone. Offered by: Biosynth. Available pack sizes: 1mg, 2mg.
(3R,4S)-6,8-dihydroxy-3,4,5-trimethyl-1-oxo-3,4-dihydroisochromene-7-carboxylic acid (CAS 65718-85-6) is a chemical compound with the molecular formula C13H14O6 and a molecular weight of 266.25 g/mol. IUPAC name: (3R,4S)-6,8-dihydroxy-3,4,5-trimethyl-1-oxo-3,4-dihydroisochromene-7-carboxylic acid. InChIKey: VVVMDYGNIVXIIG-INEUFUBQSA-N.
| Molecular formula | C13H14O6 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | (3R,4S)-6,8-dihydroxy-3,4,5-trimethyl-1-oxo-3,4-dihydroisochromene-7-carboxylic acid |
| InChIKey | VVVMDYGNIVXIIG-INEUFUBQSA-N |
| SMILES | C[C@@H]1[C@H](OC(=O)C2=C(C(=C(C(=C12)C)O)C(=O)O)O)C |
Computed by PubChem (NCBI)