Products 70311-75-0

CAS 70311-75-0 is the registry number for Methyl 4-(3,4-dimethoxyphenyl)-2,4-dioxobutanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl 4-(3,4-dimethoxyphenyl)-2,4-dioxobutanoate (CAS 70311-75-0) is a chemical compound with the molecular formula C13H14O6 and a molecular weight of 266.25 g/mol. IUPAC name: methyl 4-(3,4-dimethoxyphenyl)-2,4-dioxobutanoate. InChIKey: NWCXDAYQOSEQQS-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14O6
Molecular weight266.25 g/mol
IUPAC namemethyl 4-(3,4-dimethoxyphenyl)-2,4-dioxobutanoate
InChIKeyNWCXDAYQOSEQQS-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C=C1)C(=O)CC(=O)C(=O)OC)OC

Computed by PubChem (NCBI)