CAS 70311-75-0 is the registry number for Methyl 4-(3,4-dimethoxyphenyl)-2,4-dioxobutanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 4-(3,4-dimethoxyphenyl)-2,4-dioxobutanoate (CAS 70311-75-0) is a chemical compound with the molecular formula C13H14O6 and a molecular weight of 266.25 g/mol. IUPAC name: methyl 4-(3,4-dimethoxyphenyl)-2,4-dioxobutanoate. InChIKey: NWCXDAYQOSEQQS-UHFFFAOYSA-N.
| Molecular formula | C13H14O6 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | methyl 4-(3,4-dimethoxyphenyl)-2,4-dioxobutanoate |
| InChIKey | NWCXDAYQOSEQQS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)CC(=O)C(=O)OC)OC |
Computed by PubChem (NCBI)