Products 863985-44-8
CAS 863985-44-8 is the registry number for Hexanedioic Acid Mono-(2-carboxyphenyl) Ester. Offered by: Mikromol. Available pack sizes: 25mg, 50mg.
2-(5-carboxypentanoyloxy)benzoic acid (CAS 863985-44-8) is a chemical compound with the molecular formula C13H14O6 and a molecular weight of 266.25 g/mol. IUPAC name: 2-(5-carboxypentanoyloxy)benzoic acid. InChIKey: FAEJMUJHYMLOFI-UHFFFAOYSA-N.
| Molecular formula | C13H14O6 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 2-(5-carboxypentanoyloxy)benzoic acid |
| InChIKey | FAEJMUJHYMLOFI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)OC(=O)CCCCC(=O)O |
Computed by PubChem (NCBI)