Products 70935-15-8
CAS 70935-15-8 appears in our catalog under these names: Methyl 4-(2,5-dimethoxyphenyl)-2,4-dioxobutanoate, 95%, Methyl 4-(2,5-dimethoxyphenyl)-2,4-dioxobutanoate, 97%, Methyl 4-(2,5-dimethoxyphenyl)-2,4-dioxobutanoate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 2,5g.
Methyl 4-(2,5-dimethoxyphenyl)-2,4-dioxobutanoate (CAS 70935-15-8) is a chemical compound with the molecular formula C13H14O6 and a molecular weight of 266.25 g/mol. IUPAC name: methyl 4-(2,5-dimethoxyphenyl)-2,4-dioxobutanoate. InChIKey: FTPSUNCBLUXIAA-UHFFFAOYSA-N.
| Molecular formula | C13H14O6 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | methyl 4-(2,5-dimethoxyphenyl)-2,4-dioxobutanoate |
| InChIKey | FTPSUNCBLUXIAA-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)OC)C(=O)CC(=O)C(=O)OC |
Computed by PubChem (NCBI)