Products 38270-72-3
CAS 38270-72-3 is the registry number for 2,3-O-Benzylidene-L-tartaric acid dimethyl ester. Offered by: Biosynth. Available pack sizes: 25mg, 50mg, 100mg.
Dimethyl (4R,5R)-2-phenyl-1,3-dioxolane-4,5-dicarboxylate (CAS 38270-72-3) is a chemical compound with the molecular formula C13H14O6 and a molecular weight of 266.25 g/mol. IUPAC name: dimethyl (4R,5R)-2-phenyl-1,3-dioxolane-4,5-dicarboxylate. InChIKey: FMSYNRGOFIGJMM-NXEZZACHSA-N.
| Molecular formula | C13H14O6 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | dimethyl (4R,5R)-2-phenyl-1,3-dioxolane-4,5-dicarboxylate |
| InChIKey | FMSYNRGOFIGJMM-NXEZZACHSA-N |
| SMILES | COC(=O)[C@H]1[C@@H](OC(O1)C2=CC=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)