CAS 4105-93-5 appears in our catalog under these names: Diethyl 1,3,5-benzenetricarboxylate, 95%, DIETHYL 1,3,5-BENZENETRICARBOXYLATE, 95%(LC-MS),RG, 95%(LC-MS),RG. Offered by: Combi-blocks, Sigma-Aldrich, Chemat. Available pack sizes: 5g, 250mg, 1g.
3,5-bis(ethoxycarbonyl)benzoic acid (CAS 4105-93-5) is a chemical compound with the molecular formula C13H14O6 and a molecular weight of 266.25 g/mol. IUPAC name: 3,5-bis(ethoxycarbonyl)benzoic acid. InChIKey: GAVXMTRMXPWCCV-UHFFFAOYSA-N.
| Molecular formula | C13H14O6 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 3,5-bis(ethoxycarbonyl)benzoic acid |
| InChIKey | GAVXMTRMXPWCCV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC(=C1)C(=O)O)C(=O)OCC |
Computed by PubChem (NCBI)