Products 1354923-77-5
CAS 1354923-77-5 appears in our catalog under these names: 3-(3-Chlorophenyl)isoxazol-5-ol, 97%, 3-(3-chlorophenyl)-1,2-oxazol-5-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
3-(3-chlorophenyl)-2H-1,2-oxazol-5-one (CAS 1354923-77-5) is a chemical compound with the molecular formula C9H6ClNO2 and a molecular weight of 195.60 g/mol. IUPAC name: 3-(3-chlorophenyl)-2H-1,2-oxazol-5-one. InChIKey: FBTVJMCJMFLZCL-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2 |
|---|---|
| Molecular weight | 195.60 g/mol |
| IUPAC name | 3-(3-chlorophenyl)-2H-1,2-oxazol-5-one |
| InChIKey | FBTVJMCJMFLZCL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CC(=O)ON2 |
Computed by PubChem (NCBI)