CAS 135531-94-1 appears in our catalog under these names: 5-Methoxy-4-nitro-1H-indole-3-carbaldehyde, 95%, 5-Methoxy-4-nitro-1H-indole-3-carbaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-methoxy-4-nitro-1H-indole-3-carbaldehyde (CAS 135531-94-1) is a chemical compound with the molecular formula C10H8N2O4 and a molecular weight of 220.18 g/mol. IUPAC name: 5-methoxy-4-nitro-1H-indole-3-carbaldehyde. InChIKey: PHASPLYITRWNHW-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O4 |
|---|---|
| Molecular weight | 220.18 g/mol |
| IUPAC name | 5-methoxy-4-nitro-1H-indole-3-carbaldehyde |
| InChIKey | PHASPLYITRWNHW-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)NC=C2C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)