Products 1375303-26-6
CAS 1375303-26-6 is the registry number for 5-Allyl-2,4-dichloro-5H-pyrrolo[3,2-d]pyrimidine, >97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,4-dichloro-5-prop-2-enylpyrrolo[3,2-d]pyrimidine (CAS 1375303-26-6) is a chemical compound with the molecular formula C9H7Cl2N3 and a molecular weight of 228.07 g/mol. IUPAC name: 2,4-dichloro-5-prop-2-enylpyrrolo[3,2-d]pyrimidine. InChIKey: JUAZIHNJVOYOTK-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2N3 |
|---|---|
| Molecular weight | 228.07 g/mol |
| IUPAC name | 2,4-dichloro-5-prop-2-enylpyrrolo[3,2-d]pyrimidine |
| InChIKey | JUAZIHNJVOYOTK-UHFFFAOYSA-N |
| SMILES | C=CCN1C=CC2=C1C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)