Products 1379222-01-1
CAS 1379222-01-1 is the registry number for Methyl 2-oxo-2H,3H-(1,3)oxazolo(4,5-b)pyridine-6-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 2-oxo-3H-[1,3]oxazolo[4,5-b]pyridine-6-carboxylate (CAS 1379222-01-1) is a chemical compound with the molecular formula C8H6N2O4 and a molecular weight of 194.14 g/mol. IUPAC name: methyl 2-oxo-3H-[1,3]oxazolo[4,5-b]pyridine-6-carboxylate. InChIKey: XOYZUVUWDCVRIR-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O4 |
|---|---|
| Molecular weight | 194.14 g/mol |
| IUPAC name | methyl 2-oxo-3H-[1,3]oxazolo[4,5-b]pyridine-6-carboxylate |
| InChIKey | XOYZUVUWDCVRIR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(NC(=O)O2)N=C1 |
Computed by PubChem (NCBI)