CAS 219537-88-9 appears in our catalog under these names: 4-(2-Phenylethynyl)-1,2-benzenedicarboxylic acid, 95-<97%, 4-(2-Phenylethynyl)-1,2-benzenedicarboxylic acid, ≥97-<99%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g.
4-(2-phenylethynyl)phthalic acid (CAS 219537-88-9) is a chemical compound with the molecular formula C16H10O4 and a molecular weight of 266.25 g/mol. IUPAC name: 4-(2-phenylethynyl)phthalic acid. InChIKey: JPVBXQAUQXVQGJ-UHFFFAOYSA-N.
| Molecular formula | C16H10O4 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 4-(2-phenylethynyl)phthalic acid |
| InChIKey | JPVBXQAUQXVQGJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C#CC2=CC(=C(C=C2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)