CAS 138308-90-4 is the registry number for Anthracene–2,6–diyldimethanol. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
[6-(hydroxymethyl)anthracen-2-yl]methanol (CAS 138308-90-4) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: [6-(hydroxymethyl)anthracen-2-yl]methanol. InChIKey: ROEFUJJXSBJMDQ-UHFFFAOYSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | [6-(hydroxymethyl)anthracen-2-yl]methanol |
| InChIKey | ROEFUJJXSBJMDQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC3=C(C=CC(=C3)CO)C=C2C=C1CO |
Computed by PubChem (NCBI)