CAS 13832-10-5 appears in our catalog under these names: Diphenylethanone Impurity 3, 1,4-Diphenylbutane-2,3-dione, 98%. Offered by: Hubei YoungXin, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
1,4-diphenylbutane-2,3-dione (CAS 13832-10-5) is a chemical compound with the molecular formula C16H14O2 and a molecular weight of 238.28 g/mol. IUPAC name: 1,4-diphenylbutane-2,3-dione. InChIKey: XKBQRCUXXCGCMC-UHFFFAOYSA-N.
| Molecular formula | C16H14O2 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 1,4-diphenylbutane-2,3-dione |
| InChIKey | XKBQRCUXXCGCMC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)C(=O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)