CAS 1384895-50-4 is the registry number for 7-Nitrobenzofuran-5-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-nitro-1-benzofuran-5-ol (CAS 1384895-50-4) is a chemical compound with the molecular formula C8H5NO4 and a molecular weight of 179.13 g/mol. IUPAC name: 7-nitro-1-benzofuran-5-ol. InChIKey: ZRKWYFMNUJHRMS-UHFFFAOYSA-N.
| Molecular formula | C8H5NO4 |
|---|---|
| Molecular weight | 179.13 g/mol |
| IUPAC name | 7-nitro-1-benzofuran-5-ol |
| InChIKey | ZRKWYFMNUJHRMS-UHFFFAOYSA-N |
| SMILES | C1=COC2=C(C=C(C=C21)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)