CAS 1388056-60-7 appears in our catalog under these names: 4-Chloro-2-ethyl-7-methylthieno(3,2-d)pyrimidine, 95%, 4-Chloro-2-ethyl-7-methylthieno(3,2-d)pyrimidine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-chloro-2-ethyl-7-methylthieno[3,2-d]pyrimidine (CAS 1388056-60-7) is a chemical compound with the molecular formula C9H9ClN2S and a molecular weight of 212.70 g/mol. IUPAC name: 4-chloro-2-ethyl-7-methylthieno[3,2-d]pyrimidine. InChIKey: RDWCQBKHSLIARC-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2S |
|---|---|
| Molecular weight | 212.70 g/mol |
| IUPAC name | 4-chloro-2-ethyl-7-methylthieno[3,2-d]pyrimidine |
| InChIKey | RDWCQBKHSLIARC-UHFFFAOYSA-N |
| SMILES | CCC1=NC2=C(C(=N1)Cl)SC=C2C |
Computed by PubChem (NCBI)