CAS 83548-58-7 appears in our catalog under these names: 4-Chloro-2,5,6-trimethylthieno[2,3-d]pyrimidine, 95%, 4-Chloro-2,5,6-trimethylthieno(2,3-d)pyrimidine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg, 10g.
4-chloro-2,5,6-trimethylthieno[2,3-d]pyrimidine (CAS 83548-58-7) is a chemical compound with the molecular formula C9H9ClN2S and a molecular weight of 212.70 g/mol. IUPAC name: 4-chloro-2,5,6-trimethylthieno[2,3-d]pyrimidine. InChIKey: HDOQGBZKVBVNLU-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2S |
|---|---|
| Molecular weight | 212.70 g/mol |
| IUPAC name | 4-chloro-2,5,6-trimethylthieno[2,3-d]pyrimidine |
| InChIKey | HDOQGBZKVBVNLU-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=NC(=N2)C)Cl)C |
Computed by PubChem (NCBI)