CAS 152998-85-1 appears in our catalog under these names: 4-Chloro-6-ethyl-2-methylthieno(2,3-d)pyrimidine, 97%, 4-Chloro-6-ethyl-2-methylthieno(2,3-d)pyrimidine, 4-Chloro-6-ethyl-2-methylthieno[2,3-d]pyrimidine, 97%, 97%, 4-Chloro-6-ethyl-2-methylthieno[2,3-d]pyrimidine, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 50mg, 0,5g, 100mg, 250mg, 1g, 500mg, 2.5g.
4-chloro-6-ethyl-2-methylthieno[2,3-d]pyrimidine (CAS 152998-85-1) is a chemical compound with the molecular formula C9H9ClN2S and a molecular weight of 212.70 g/mol. IUPAC name: 4-chloro-6-ethyl-2-methylthieno[2,3-d]pyrimidine. InChIKey: MLNSNVDZJYXEMZ-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2S |
|---|---|
| Molecular weight | 212.70 g/mol |
| IUPAC name | 4-chloro-6-ethyl-2-methylthieno[2,3-d]pyrimidine |
| InChIKey | MLNSNVDZJYXEMZ-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(S1)N=C(N=C2Cl)C |
Computed by PubChem (NCBI)