CAS 876316-61-9 is the registry number for 3-(Chloromethyl)-1-methyl-5-thien-2-yl-1H-pyrazole, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.
3-(chloromethyl)-1-methyl-5-thiophen-2-ylpyrazole (CAS 876316-61-9) is a chemical compound with the molecular formula C9H9ClN2S and a molecular weight of 212.70 g/mol. IUPAC name: 3-(chloromethyl)-1-methyl-5-thiophen-2-ylpyrazole. InChIKey: ODLZAEGCJDMPOT-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2S |
|---|---|
| Molecular weight | 212.70 g/mol |
| IUPAC name | 3-(chloromethyl)-1-methyl-5-thiophen-2-ylpyrazole |
| InChIKey | ODLZAEGCJDMPOT-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)CCl)C2=CC=CS2 |
Computed by PubChem (NCBI)