CAS 439692-52-1 appears in our catalog under these names: 4-Chloro-6-isopropylthieno[2,3-d]pyrimidine, 95%, 4–Chloro–6–Isopropyl–Thieno(2,3–D)Pyrimidine, 4-Chloro-6-isopropylthieno[2,3-d]pyrimidine 95%, 4-Chloro-6-isopropylthieno[2,3-d]pyrimidine, 95%, 95%, 4-Chloro-6-isopropyl-thieno[2,3-d]pyrimidine, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
4-chloro-6-propan-2-ylthieno[2,3-d]pyrimidine (CAS 439692-52-1) is a chemical compound with the molecular formula C9H9ClN2S and a molecular weight of 212.70 g/mol. IUPAC name: 4-chloro-6-propan-2-ylthieno[2,3-d]pyrimidine. InChIKey: HOXIDKJKRREVOH-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2S |
|---|---|
| Molecular weight | 212.70 g/mol |
| IUPAC name | 4-chloro-6-propan-2-ylthieno[2,3-d]pyrimidine |
| InChIKey | HOXIDKJKRREVOH-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC2=C(S1)N=CN=C2Cl |
Computed by PubChem (NCBI)