CAS 439692-90-7 is the registry number for 4-Chloro-5-ethyl-6-methylthieno[2,3-d]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-chloro-5-ethyl-6-methylthieno[2,3-d]pyrimidine (CAS 439692-90-7) is a chemical compound with the molecular formula C9H9ClN2S and a molecular weight of 212.70 g/mol. IUPAC name: 4-chloro-5-ethyl-6-methylthieno[2,3-d]pyrimidine. InChIKey: SDTNZUUFPBXYEW-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2S |
|---|---|
| Molecular weight | 212.70 g/mol |
| IUPAC name | 4-chloro-5-ethyl-6-methylthieno[2,3-d]pyrimidine |
| InChIKey | SDTNZUUFPBXYEW-UHFFFAOYSA-N |
| SMILES | CCC1=C(SC2=C1C(=NC=N2)Cl)C |
Computed by PubChem (NCBI)