CAS 2171815-20-4 appears in our catalog under these names: 2-(1,3-thiazol-2-yl)aniline hydrochloride, 95%, 2-(1,3-Thiazol-2-yl)aniline hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-(1,3-thiazol-2-yl)aniline;hydrochloride (CAS 2171815-20-4) is a chemical compound with the molecular formula C9H9ClN2S and a molecular weight of 212.70 g/mol. IUPAC name: 2-(1,3-thiazol-2-yl)aniline;hydrochloride. InChIKey: WARDEHIEHALMGJ-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2S |
|---|---|
| Molecular weight | 212.70 g/mol |
| IUPAC name | 2-(1,3-thiazol-2-yl)aniline;hydrochloride |
| InChIKey | WARDEHIEHALMGJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC=CS2)N.Cl |
Computed by PubChem (NCBI)