CAS 944887-78-9 is the registry number for 6-Chloro-4-ethyl-1,3-benzothiazol-2-amine, 97%. Offered by: Combi-blocks. Available pack sizes: 1g.
6-chloro-4-ethyl-1,3-benzothiazol-2-amine (CAS 944887-78-9) is a chemical compound with the molecular formula C9H9ClN2S and a molecular weight of 212.70 g/mol. IUPAC name: 6-chloro-4-ethyl-1,3-benzothiazol-2-amine. InChIKey: OADRHUOFOMNMJZ-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2S |
|---|---|
| Molecular weight | 212.70 g/mol |
| IUPAC name | 6-chloro-4-ethyl-1,3-benzothiazol-2-amine |
| InChIKey | OADRHUOFOMNMJZ-UHFFFAOYSA-N |
| SMILES | CCC1=C2C(=CC(=C1)Cl)SC(=N2)N |
Computed by PubChem (NCBI)