CAS 685124-12-3 is the registry number for 5-Chloro-N-ethyl-1,3-benzothiazol-2-amine. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
5-chloro-N-ethyl-1,3-benzothiazol-2-amine (CAS 685124-12-3) is a chemical compound with the molecular formula C9H9ClN2S and a molecular weight of 212.70 g/mol. IUPAC name: 5-chloro-N-ethyl-1,3-benzothiazol-2-amine. InChIKey: RWENKNLXLIFVIP-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2S |
|---|---|
| Molecular weight | 212.70 g/mol |
| IUPAC name | 5-chloro-N-ethyl-1,3-benzothiazol-2-amine |
| InChIKey | RWENKNLXLIFVIP-UHFFFAOYSA-N |
| SMILES | CCNC1=NC2=C(S1)C=CC(=C2)Cl |
Computed by PubChem (NCBI)