Products 1392307-42-4
CAS 1392307-42-4 is the registry number for 3',4'-Dihydroxy-2-o-methylanigorufone. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote.
9-(3,4-dihydroxyphenyl)-2-methoxyphenalen-1-one (CAS 1392307-42-4) is a chemical compound with the molecular formula C20H14O4 and a molecular weight of 318.3 g/mol. IUPAC name: 9-(3,4-dihydroxyphenyl)-2-methoxyphenalen-1-one. InChIKey: SBGZHCKQMDLHHL-UHFFFAOYSA-N.
| Molecular formula | C20H14O4 |
|---|---|
| Molecular weight | 318.3 g/mol |
| IUPAC name | 9-(3,4-dihydroxyphenyl)-2-methoxyphenalen-1-one |
| InChIKey | SBGZHCKQMDLHHL-UHFFFAOYSA-N |
| SMILES | COC1=CC2=CC=CC3=C2C(=C(C=C3)C4=CC(=C(C=C4)O)O)C1=O |
Computed by PubChem (NCBI)