Products 1409411-32-0
CAS 1409411-32-0 is the registry number for ST-1892. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]benzoic acid (CAS 1409411-32-0) is a chemical compound with the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. IUPAC name: 3-[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]benzoic acid. InChIKey: WHNBOVWEWUVNOZ-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O3 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | 3-[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]benzoic acid |
| InChIKey | WHNBOVWEWUVNOZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=NOC(=N2)C3=CC(=CC=C3)C(=O)O |
Computed by PubChem (NCBI)