Products 1415089-91-6
CAS 1415089-91-6 is the registry number for Methyl 5-(aminomethyl)-2-(trifluoromethyl)benzoate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 5-(aminomethyl)-2-(trifluoromethyl)benzoate;hydrochloride (CAS 1415089-91-6) is a chemical compound with the molecular formula C10H11ClF3NO2 and a molecular weight of 269.65 g/mol. IUPAC name: methyl 5-(aminomethyl)-2-(trifluoromethyl)benzoate;hydrochloride. InChIKey: ZWHCRPHTAZSYIM-UHFFFAOYSA-N.
| Molecular formula | C10H11ClF3NO2 |
|---|---|
| Molecular weight | 269.65 g/mol |
| IUPAC name | methyl 5-(aminomethyl)-2-(trifluoromethyl)benzoate;hydrochloride |
| InChIKey | ZWHCRPHTAZSYIM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)CN)C(F)(F)F.Cl |
Computed by PubChem (NCBI)