Products 1417363-72-4
CAS 1417363-72-4 appears in our catalog under these names: 2-(2,6-Dichlorophenoxy)ethan-1-amine hydrochloride, 95%, 2-(2,6-Dichlorophenoxy)ethan-1-amine hydrochloride, 95%, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g.
2-(2,6-dichlorophenoxy)ethanamine;hydrochloride (CAS 1417363-72-4) is a chemical compound with the molecular formula C8H10Cl3NO and a molecular weight of 242.5 g/mol. IUPAC name: 2-(2,6-dichlorophenoxy)ethanamine;hydrochloride. InChIKey: IAHOZYRIUBVJSC-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl3NO |
|---|---|
| Molecular weight | 242.5 g/mol |
| IUPAC name | 2-(2,6-dichlorophenoxy)ethanamine;hydrochloride |
| InChIKey | IAHOZYRIUBVJSC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)OCCN)Cl.Cl |
Computed by PubChem (NCBI)