CAS 14191-22-1 appears in our catalog under these names: 2–Nitro–9H–carbazole, 2-Nitro-9H-carbazole. Offered by: GLPBio, Biosynth. Available pack sizes: 1mg, 5mg, 1g, 2,5g.
2-nitro-9H-carbazole (CAS 14191-22-1) is a chemical compound with the molecular formula C12H8N2O2 and a molecular weight of 212.20 g/mol. IUPAC name: 2-nitro-9H-carbazole. InChIKey: RSSFRJAJZYDBDI-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O2 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 2-nitro-9H-carbazole |
| InChIKey | RSSFRJAJZYDBDI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)