CAS 1422496-28-3 appears in our catalog under these names: 2,4-Dichloro-1,6-naphthyridine, 97%, 2,4-Dichloro-1,6-naphthyridine, 2,4-Dichloro-1,6-naphthyridine 95%, 2,4-Dichloro-1,6-naphthyridine, 97%, 97%, 2,4-Dichloro-1,6-naphthyridine, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 0,1g, 0,25g, 0,5g, 2g, 1g, 100mg, 250mg.
2,4-dichloro-1,6-naphthyridine (CAS 1422496-28-3) is a chemical compound with the molecular formula C8H4Cl2N2 and a molecular weight of 199.03 g/mol. IUPAC name: 2,4-dichloro-1,6-naphthyridine. InChIKey: GTIAUBNKVKIRAG-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2N2 |
|---|---|
| Molecular weight | 199.03 g/mol |
| IUPAC name | 2,4-dichloro-1,6-naphthyridine |
| InChIKey | GTIAUBNKVKIRAG-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=C1N=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)